About 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid
2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid (PubChem CID 129210510) has the molecular formula C25H23ClN2O2
and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid |
| PubChem CID | 129210510 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid |
| SMILES | Cc1ccc2nc(-c3ccc(Cl)cc3)c(CCC3=CC(CC(=O)O)CC=C3)nc2c1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-16-5-11-21-23(13-16)27-22(25(28-21)19-7-9-20(26)10-8-19)12-6-17-3-2-4-18(14-17)15-24(29)30/h2-3,5,7-11,13-14,18H,4,6,12,15H2,1H3,(H,29,30) |
| InChIKey | OUKGTSSLDJIZQR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid?
The IUPAC name of 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid (CID 129210510) is 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid?
The canonical SMILES for 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid is Cc1ccc2nc(-c3ccc(Cl)cc3)c(CCC3=CC(CC(=O)O)CC=C3)nc2c1.
What is the InChIKey of 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid?
The InChIKey is OUKGTSSLDJIZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23ClN2O2/c1-16-5-11-21-23(13-16)27-22(25(28-21)19-7-9-20(26)10-8-19)12-6-17-3-2-4-18(14-17)15-24(29)30/h2-3,5,7-11,13-14,18H,4,6,12,15H2,1H3,(H,29,30).
What are the key properties of 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid?
2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid has a molecular weight of 418.92 g/mol, XLogP of 6.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-[3-(4-chlorophenyl)-7-methylquinoxalin-2-yl]ethyl]cyclohexa-2,4-dien-1-yl]acetic acid is sourced from PubChem (CID 129210510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).