C29H41N3 — CID 129210584
(3E)-6-[(Z)-hex-4-enyl]-5-(5-methylhepta-5,6-dienyl)-3-[(2E)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienylidene]-2H-pyrazine (PubChem CID 129210584) has the molecular formula C29H41N3 and a molecular weight of 431.67 g/mol. Its IUPAC name is (3E)-6-[(Z)-hex-4-enyl]-5-(5-methylhepta-5,6-dienyl)-3-[(2E)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienylidene]-2H-pyrazine.
| Compound Name | (3E)-6-[(Z)-hex-4-enyl]-5-(5-methylhepta-5,6-dienyl)-3-[(2E)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienylidene]-2H-pyrazine |
|---|---|
| PubChem CID | 129210584 |
| Molecular Formula | C29H41N3 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | (3E)-6-[(Z)-hex-4-enyl]-5-(5-methylhepta-5,6-dienyl)-3-[(2E)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienylidene]-2H-pyrazine |
| SMILES | C=C=C(C)CCCCC1=N/C(=C/C(=C\C=C)C(=C)N2CCCC2)CN=C1CCC/C=C\C |
| InChI | InChI=1S/C29H41N3/c1-6-9-10-11-18-28-29(19-13-12-17-24(4)8-3)31-27(23-30-28)22-26(16-7-2)25(5)32-20-14-15-21-32/h6-7,9,16,22H,2-3,5,10-15,17-21,23H2,1,4H3/b9-6-,26-16+,27-22+ |
| InChIKey | STLCFZJEVUZKHR-NJWMCMMASA-N |
| XLogP | 7.53 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|