About 7-fluoro-3,4,7,8-tetrahydro-2H-chromene
7-fluoro-3,4,7,8-tetrahydro-2H-chromene (PubChem CID 129210684) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is 7-fluoro-3,4,7,8-tetrahydro-2H-chromene.
Molecular Properties
| Compound Name | 7-fluoro-3,4,7,8-tetrahydro-2H-chromene |
| PubChem CID | 129210684 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 7-fluoro-3,4,7,8-tetrahydro-2H-chromene |
| SMILES | FC1C=CC2=C(C1)OCCC2 |
| InChI | InChI=1S/C9H11FO/c10-8-4-3-7-2-1-5-11-9(7)6-8/h3-4,8H,1-2,5-6H2 |
| InChIKey | VPGBJQUWQZVJHF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-3,4,7,8-tetrahydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3,4,7,8-tetrahydro-2H-chromene?
The IUPAC name of 7-fluoro-3,4,7,8-tetrahydro-2H-chromene (CID 129210684) is 7-fluoro-3,4,7,8-tetrahydro-2H-chromene.
What is the SMILES notation for 7-fluoro-3,4,7,8-tetrahydro-2H-chromene?
The canonical SMILES for 7-fluoro-3,4,7,8-tetrahydro-2H-chromene is FC1C=CC2=C(C1)OCCC2.
What is the InChIKey of 7-fluoro-3,4,7,8-tetrahydro-2H-chromene?
The InChIKey is VPGBJQUWQZVJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO/c10-8-4-3-7-2-1-5-11-9(7)6-8/h3-4,8H,1-2,5-6H2.
What are the key properties of 7-fluoro-3,4,7,8-tetrahydro-2H-chromene?
7-fluoro-3,4,7,8-tetrahydro-2H-chromene has a molecular weight of 154.18 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3,4,7,8-tetrahydro-2H-chromene is sourced from PubChem (CID 129210684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).