About 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid
5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid (PubChem CID 129210703) has the molecular formula C21H26N2O2
and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid.
Molecular Properties
| Compound Name | 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid |
| PubChem CID | 129210703 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid |
| SMILES | C=CCC/C=C(\C)c1nc2ccc(C)cc2nc1CCCCC(=O)O |
| InChI | InChI=1S/C21H26N2O2/c1-4-5-6-9-16(3)21-18(10-7-8-11-20(24)25)22-19-14-15(2)12-13-17(19)23-21/h4,9,12-14H,1,5-8,10-11H2,2-3H3,(H,24,25)/b16-9+ |
| InChIKey | KALAHSLIHJFQAU-CXUHLZMHSA-N |
| XLogP | 5.11 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid?
The IUPAC name of 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid (CID 129210703) is 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid.
What is the SMILES notation for 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid?
The canonical SMILES for 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid is C=CCC/C=C(\C)c1nc2ccc(C)cc2nc1CCCCC(=O)O.
What is the InChIKey of 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid?
The InChIKey is KALAHSLIHJFQAU-CXUHLZMHSA-N. The full InChI is InChI=1S/C21H26N2O2/c1-4-5-6-9-16(3)21-18(10-7-8-11-20(24)25)22-19-14-15(2)12-13-17(19)23-21/h4,9,12-14H,1,5-8,10-11H2,2-3H3,(H,24,25)/b16-9+.
What are the key properties of 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid?
5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid has a molecular weight of 338.45 g/mol, XLogP of 5.11, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(2E)-hepta-2,6-dien-2-yl]-7-methylquinoxalin-2-yl]pentanoic acid is sourced from PubChem (CID 129210703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).