C57H68O2 — CID 129210909
3-[3-(4-tert-butylphenyl)-5-[2-[3-(4-tert-butylphenyl)-4-methoxy-5-(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-1,2,4,5-tetramethylbenzene (PubChem CID 129210909) has the molecular formula C57H68O2 and a molecular weight of 785.17 g/mol. Its IUPAC name is 3-[3-(4-tert-butylphenyl)-5-[2-[3-(4-tert-butylphenyl)-4-methoxy-5-(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-[3-(4-tert-butylphenyl)-5-[2-[3-(4-tert-butylphenyl)-4-methoxy-5-(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 129210909 |
| Molecular Formula | C57H68O2 |
| Molecular Weight | 785.17 g/mol |
| Exact Mass | 784.52 |
| IUPAC Name | 3-[3-(4-tert-butylphenyl)-5-[2-[3-(4-tert-butylphenyl)-4-methoxy-5-(2,3,5,6-tetramethylphenyl)phenyl]propan-2-yl]-2-methoxyphenyl]-1,2,4,5-tetramethylbenzene |
| SMILES | COc1c(-c2ccc(C(C)(C)C)cc2)cc(C(C)(C)c2cc(-c3ccc(C(C)(C)C)cc3)c(OC)c(-c3c(C)c(C)cc(C)c3C)c2)cc1-c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C57H68O2/c1-33-27-34(2)38(6)51(37(33)5)49-31-45(29-47(53(49)58-17)41-19-23-43(24-20-41)55(9,10)11)57(15,16)46-30-48(42-21-25-44(26-22-42)56(12,13)14)54(59-18)50(32-46)52-39(7)35(3)28-36(4)40(52)8/h19-32H,1-18H3 |
| InChIKey | ZGEVXALGJZZYSG-UHFFFAOYSA-N |
| XLogP | 15.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.17 |
| LogP ≤ 5 | 15.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |