C22H19Cl2F3N6O3S — CID 129211877
5-chloro-N-[1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]-hydroxymethyl]-1,3-thiazol-2-yl]ethyl]-6-(5-hydroxypent-1-ynyl)pyrimidine-4-carboxamide (PubChem CID 129211877) has the molecular formula C22H19Cl2F3N6O3S and a molecular weight of 575.40 g/mol. Its IUPAC name is 5-chloro-N-[1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]-hydroxymethyl]-1,3-thiazol-2-yl]ethyl]-6-(5-hydroxypent-1-ynyl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]-hydroxymethyl]-1,3-thiazol-2-yl]ethyl]-6-(5-hydroxypent-1-ynyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 129211877 |
| Molecular Formula | C22H19Cl2F3N6O3S |
| Molecular Weight | 575.40 g/mol |
| Exact Mass | 574.06 |
| IUPAC Name | 5-chloro-N-[1-[5-[[[5-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]-hydroxymethyl]-1,3-thiazol-2-yl]ethyl]-6-(5-hydroxypent-1-ynyl)pyrimidine-4-carboxamide |
| SMILES | CC(NC(=O)c1ncnc(C#CCCCO)c1Cl)c1ncc(C(O)Nc2cc(C(F)(F)F)c(Cl)cn2)s1 |
| InChI | InChI=1S/C22H19Cl2F3N6O3S/c1-11(32-20(36)18-17(24)14(30-10-31-18)5-3-2-4-6-34)21-29-9-15(37-21)19(35)33-16-7-12(22(25,26)27)13(23)8-28-16/h7-11,19,34-35H,2,4,6H2,1H3,(H,28,33)(H,32,36) |
| InChIKey | SCUGSCCWVDREIO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|