C15H15N3O — CID 129212277
1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-(1H-pyrazol-4-yl)pyridin-2-one (PubChem CID 129212277) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-(1H-pyrazol-4-yl)pyridin-2-one.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-(1H-pyrazol-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 129212277 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-(1H-pyrazol-4-yl)pyridin-2-one |
| SMILES | C=C/C=C\C=C(/C)n1cc(-c2cn[nH]c2)ccc1=O |
| InChI | InChI=1S/C15H15N3O/c1-3-4-5-6-12(2)18-11-13(7-8-15(18)19)14-9-16-17-10-14/h3-11H,1H2,2H3,(H,16,17)/b5-4-,12-6+ |
| InChIKey | XXWZCCUUKAYZKE-QENXGIAESA-N |
| XLogP | 2.84 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|