About 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite
2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite (PubChem CID 129212452) has the molecular formula C7H11FO4
and a molecular weight of 178.16 g/mol. Its IUPAC name is 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite.
Molecular Properties
| Compound Name | 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite |
| PubChem CID | 129212452 |
| Molecular Formula | C7H11FO4 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite |
| SMILES | O=C1C[C@H](O)C[C@@H](CCOF)O1 |
| InChI | InChI=1S/C7H11FO4/c8-11-2-1-6-3-5(9)4-7(10)12-6/h5-6,9H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | CQYCOPWLNIXAQE-PHDIDXHHSA-N |
| XLogP | 0.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite?
The IUPAC name of 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite (CID 129212452) is 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite.
What is the SMILES notation for 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite?
The canonical SMILES for 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite is O=C1C[C@H](O)C[C@@H](CCOF)O1.
What is the InChIKey of 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite?
The InChIKey is CQYCOPWLNIXAQE-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H11FO4/c8-11-2-1-6-3-5(9)4-7(10)12-6/h5-6,9H,1-4H2/t5-,6-/m1/s1.
What are the key properties of 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite?
2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite has a molecular weight of 178.16 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl hypofluorite is sourced from PubChem (CID 129212452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).