About ethanamine;ethylcarbamic acid
ethanamine;ethylcarbamic acid (PubChem CID 12921251) has the molecular formula C5H14N2O2
and a molecular weight of 134.18 g/mol. Its IUPAC name is ethanamine;ethylcarbamic acid.
Molecular Properties
| Compound Name | ethanamine;ethylcarbamic acid |
| PubChem CID | 12921251 |
| Molecular Formula | C5H14N2O2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | ethanamine;ethylcarbamic acid |
| SMILES | CCN.CCNC(=O)O |
| InChI | InChI=1S/C3H7NO2.C2H7N/c1-2-4-3(5)6;1-2-3/h4H,2H2,1H3,(H,5,6);2-3H2,1H3 |
| InChIKey | GPUHGQYNYJIMDZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanamine;ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;ethylcarbamic acid?
The IUPAC name of ethanamine;ethylcarbamic acid (CID 12921251) is ethanamine;ethylcarbamic acid.
What is the SMILES notation for ethanamine;ethylcarbamic acid?
The canonical SMILES for ethanamine;ethylcarbamic acid is CCN.CCNC(=O)O.
What is the InChIKey of ethanamine;ethylcarbamic acid?
The InChIKey is GPUHGQYNYJIMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C2H7N/c1-2-4-3(5)6;1-2-3/h4H,2H2,1H3,(H,5,6);2-3H2,1H3.
What are the key properties of ethanamine;ethylcarbamic acid?
ethanamine;ethylcarbamic acid has a molecular weight of 134.18 g/mol, XLogP of 0.24, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;ethylcarbamic acid is sourced from PubChem (CID 12921251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).