About propan-2-amine;propan-2-ylcarbamic acid
propan-2-amine;propan-2-ylcarbamic acid (PubChem CID 12921252) has the molecular formula C7H18N2O2
and a molecular weight of 162.23 g/mol. Its IUPAC name is propan-2-amine;propan-2-ylcarbamic acid.
Molecular Properties
| Compound Name | propan-2-amine;propan-2-ylcarbamic acid |
| PubChem CID | 12921252 |
| Molecular Formula | C7H18N2O2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | propan-2-amine;propan-2-ylcarbamic acid |
| SMILES | CC(C)N.CC(C)NC(=O)O |
| InChI | InChI=1S/C4H9NO2.C3H9N/c1-3(2)5-4(6)7;1-3(2)4/h3,5H,1-2H3,(H,6,7);3H,4H2,1-2H3 |
| InChIKey | MPXHWRXXJUKENG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-amine;propan-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine;propan-2-ylcarbamic acid?
The IUPAC name of propan-2-amine;propan-2-ylcarbamic acid (CID 12921252) is propan-2-amine;propan-2-ylcarbamic acid.
What is the SMILES notation for propan-2-amine;propan-2-ylcarbamic acid?
The canonical SMILES for propan-2-amine;propan-2-ylcarbamic acid is CC(C)N.CC(C)NC(=O)O.
What is the InChIKey of propan-2-amine;propan-2-ylcarbamic acid?
The InChIKey is MPXHWRXXJUKENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.C3H9N/c1-3(2)5-4(6)7;1-3(2)4/h3,5H,1-2H3,(H,6,7);3H,4H2,1-2H3.
What are the key properties of propan-2-amine;propan-2-ylcarbamic acid?
propan-2-amine;propan-2-ylcarbamic acid has a molecular weight of 162.23 g/mol, XLogP of 1.02, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine;propan-2-ylcarbamic acid is sourced from PubChem (CID 12921252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).