About (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine
(5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine (PubChem CID 129212564) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine.
Molecular Properties
| Compound Name | (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine |
| PubChem CID | 129212564 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine |
| SMILES | C=C/C=C(\C=C)C(C)CC(C)CN |
| InChI | InChI=1S/C12H21N/c1-5-7-12(6-2)11(4)8-10(3)9-13/h5-7,10-11H,1-2,8-9,13H2,3-4H3/b12-7+ |
| InChIKey | OADZEXSPJRBJBH-KPKJPENVSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine?
The IUPAC name of (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine (CID 129212564) is (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine.
What is the SMILES notation for (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine?
The canonical SMILES for (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine is C=C/C=C(\C=C)C(C)CC(C)CN.
What is the InChIKey of (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine?
The InChIKey is OADZEXSPJRBJBH-KPKJPENVSA-N. The full InChI is InChI=1S/C12H21N/c1-5-7-12(6-2)11(4)8-10(3)9-13/h5-7,10-11H,1-2,8-9,13H2,3-4H3/b12-7+.
What are the key properties of (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine?
(5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine has a molecular weight of 179.31 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-ethenyl-2,4-dimethylocta-5,7-dien-1-amine is sourced from PubChem (CID 129212564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).