C47H70N2 — CID 129212582
1-N,2-N-dimethyl-3-(2-methylbutan-2-yl)-6-[7-(2-methylbutan-2-yl)-9,9-dioctylfluoren-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 129212582) has the molecular formula C47H70N2 and a molecular weight of 663.09 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3-(2-methylbutan-2-yl)-6-[7-(2-methylbutan-2-yl)-9,9-dioctylfluoren-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N-dimethyl-3-(2-methylbutan-2-yl)-6-[7-(2-methylbutan-2-yl)-9,9-dioctylfluoren-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 129212582 |
| Molecular Formula | C47H70N2 |
| Molecular Weight | 663.09 g/mol |
| Exact Mass | 662.55 |
| IUPAC Name | 1-N,2-N-dimethyl-3-(2-methylbutan-2-yl)-6-[7-(2-methylbutan-2-yl)-9,9-dioctylfluoren-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C3=CC=C(C(C)(C)CC)C(=N/C)/C3=N\C)ccc2-c2ccc(C(C)(C)CC)cc21 |
| InChI | InChI=1S/C47H70N2/c1-11-15-17-19-21-23-31-47(32-24-22-20-18-16-12-2)41-33-35(37-29-30-40(46(7,8)14-4)44(49-10)43(37)48-9)25-27-38(41)39-28-26-36(34-42(39)47)45(5,6)13-3/h25-30,33-34H,11-24,31-32H2,1-10H3/b48-43-,49-44- |
| InChIKey | ZOLKLHKEFFARCG-GXDDXODVSA-N |
| XLogP | 14.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.09 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|