C31H48N2 — CID 129212588
3-[(2E,4E)-6-ethyl-5,6-dimethylocta-2,4-dien-2-yl]-1-N,2-N-dimethyl-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 129212588) has the molecular formula C31H48N2 and a molecular weight of 448.74 g/mol. Its IUPAC name is 3-[(2E,4E)-6-ethyl-5,6-dimethylocta-2,4-dien-2-yl]-1-N,2-N-dimethyl-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3-[(2E,4E)-6-ethyl-5,6-dimethylocta-2,4-dien-2-yl]-1-N,2-N-dimethyl-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 129212588 |
| Molecular Formula | C31H48N2 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 448.38 |
| IUPAC Name | 3-[(2E,4E)-6-ethyl-5,6-dimethylocta-2,4-dien-2-yl]-1-N,2-N-dimethyl-6-[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCC(C)(C)/C(C)=C/C=C(\C)C1=CC=C(/C(C)=C/C=C(\C)C(C)(CC)CC)C(=N/C)/C1=N/C |
| InChI | InChI=1S/C31H48N2/c1-13-30(8,9)24(6)18-16-22(4)26-20-21-27(29(33-12)28(26)32-11)23(5)17-19-25(7)31(10,14-2)15-3/h16-21H,13-15H2,1-12H3/b22-16+,23-17+,24-18+,25-19+,32-28+,33-29- |
| InChIKey | URULGJLWNJHLFJ-AGCFLYEJSA-N |
| XLogP | 9.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|