C38H75N3O6 — CID 129212632
4-[1,5-bis[(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxy]pentoxy]-1-methoxy-2,2,7,7-tetramethylazepane (PubChem CID 129212632) has the molecular formula C38H75N3O6 and a molecular weight of 670.03 g/mol. Its IUPAC name is 4-[1,5-bis[(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxy]pentoxy]-1-methoxy-2,2,7,7-tetramethylazepane.
| Compound Name | 4-[1,5-bis[(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxy]pentoxy]-1-methoxy-2,2,7,7-tetramethylazepane |
|---|---|
| PubChem CID | 129212632 |
| Molecular Formula | C38H75N3O6 |
| Molecular Weight | 670.03 g/mol |
| Exact Mass | 669.57 |
| IUPAC Name | 4-[1,5-bis[(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxy]pentoxy]-1-methoxy-2,2,7,7-tetramethylazepane |
| SMILES | CON1C(C)(C)CCC(OCCCCC(OC2CCC(C)(C)N(OC)C(C)(C)C2)OC2CCC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C38H75N3O6/c1-33(2)22-19-29(26-36(7,8)39(33)42-13)45-25-17-16-18-32(46-30-20-23-34(3,4)40(43-14)37(9,10)27-30)47-31-21-24-35(5,6)41(44-15)38(11,12)28-31/h29-32H,16-28H2,1-15H3 |
| InChIKey | XXIFQDQROPUOHL-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.03 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|