C38H67N3O6 — CID 129212726
4-[2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)oxy-5-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxyphenoxy]-1-methoxy-2,2,7,7-tetramethylazepane (PubChem CID 129212726) has the molecular formula C38H67N3O6 and a molecular weight of 661.97 g/mol. Its IUPAC name is 4-[2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)oxy-5-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxyphenoxy]-1-methoxy-2,2,7,7-tetramethylazepane.
| Compound Name | 4-[2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)oxy-5-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxyphenoxy]-1-methoxy-2,2,7,7-tetramethylazepane |
|---|---|
| PubChem CID | 129212726 |
| Molecular Formula | C38H67N3O6 |
| Molecular Weight | 661.97 g/mol |
| Exact Mass | 661.50 |
| IUPAC Name | 4-[2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)oxy-5-(1-methoxy-2,2,7,7-tetramethylazepan-4-yl)oxyphenoxy]-1-methoxy-2,2,7,7-tetramethylazepane |
| SMILES | CON1C(C)(C)CCC(Oc2ccc(OC3CCC(C)(C)N(O)C(C)(C)C3)c(OC3CCC(C)(C)N(OC)C(C)(C)C3)c2)CC1(C)C |
| InChI | InChI=1S/C38H67N3O6/c1-33(2)20-17-29(24-36(7,8)39(33)42)46-31-16-15-27(45-28-18-21-34(3,4)40(43-13)37(9,10)25-28)23-32(31)47-30-19-22-35(5,6)41(44-14)38(11,12)26-30/h15-16,23,28-30,42H,17-22,24-26H2,1-14H3 |
| InChIKey | YNDAMAUXQWFURF-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.97 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |