C20H21ClFN2O9P — CID 129213311
1-[(1R,3R,4R,5S)-6-[[(2S,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-4-fluoro-5-(hydroxymethoxy)-4-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione (PubChem CID 129213311) has the molecular formula C20H21ClFN2O9P and a molecular weight of 518.82 g/mol. Its IUPAC name is 1-[(1R,3R,4R,5S)-6-[[(2S,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-4-fluoro-5-(hydroxymethoxy)-4-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3R,4R,5S)-6-[[(2S,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-4-fluoro-5-(hydroxymethoxy)-4-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129213311 |
| Molecular Formula | C20H21ClFN2O9P |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 1-[(1R,3R,4R,5S)-6-[[(2S,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-4-fluoro-5-(hydroxymethoxy)-4-methyl-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione |
| SMILES | C[C@]1(F)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]2C(O[P@@]3(=O)OCC[C@@H](c4cccc(Cl)c4)O3)[C@@]21OCO |
| InChI | InChI=1S/C20H21ClFN2O9P/c1-19(22)17(24-7-5-14(26)23-18(24)27)31-15-16(20(15,19)29-10-25)33-34(28)30-8-6-13(32-34)11-3-2-4-12(21)9-11/h2-5,7,9,13,15-17,25H,6,8,10H2,1H3,(H,23,26,27)/t13-,15+,16?,17+,19-,20-,34-/m0/s1 |
| InChIKey | MAQZRXDGCLTLAA-NAOUEJBDSA-N |
| XLogP | 2.21 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|