About 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one
7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one (PubChem CID 129213484) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one.
Molecular Properties
| Compound Name | 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
| PubChem CID | 129213484 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one |
| SMILES | CC(C)CC12CC(=O)C(C)(O1)C1CCC(C)C1C2O |
| InChI | InChI=1S/C16H26O3/c1-9(2)7-16-8-12(17)15(4,19-16)11-6-5-10(3)13(11)14(16)18/h9-11,13-14,18H,5-8H2,1-4H3 |
| InChIKey | IRTAMGCDPSQFRX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
The IUPAC name of 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one (CID 129213484) is 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one.
What is the SMILES notation for 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
The canonical SMILES for 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one is CC(C)CC12CC(=O)C(C)(O1)C1CCC(C)C1C2O.
What is the InChIKey of 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
The InChIKey is IRTAMGCDPSQFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O3/c1-9(2)7-16-8-12(17)15(4,19-16)11-6-5-10(3)13(11)14(16)18/h9-11,13-14,18H,5-8H2,1-4H3.
What are the key properties of 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one?
7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one has a molecular weight of 266.38 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1,5-dimethyl-8-(2-methylpropyl)-11-oxatricyclo[6.2.1.02,6]undecan-10-one is sourced from PubChem (CID 129213484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).