About 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine
3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine (PubChem CID 129213499) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine |
| PubChem CID | 129213499 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine |
| SMILES | CC(C)(C)Cc1cc2[nH]ccc2nn1 |
| InChI | InChI=1S/C11H15N3/c1-11(2,3)7-8-6-10-9(14-13-8)4-5-12-10/h4-6,12H,7H2,1-3H3 |
| InChIKey | AAARZLZHGDSSAX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine?
The IUPAC name of 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine (CID 129213499) is 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine.
What is the SMILES notation for 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine?
The canonical SMILES for 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine is CC(C)(C)Cc1cc2[nH]ccc2nn1.
What is the InChIKey of 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine?
The InChIKey is AAARZLZHGDSSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-11(2,3)7-8-6-10-9(14-13-8)4-5-12-10/h4-6,12H,7H2,1-3H3.
What are the key properties of 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine?
3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine has a molecular weight of 189.26 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropyl)-5H-pyrrolo[3,2-c]pyridazine is sourced from PubChem (CID 129213499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).