C10H11F3N2O5 — CID 129213637
(3-methyl-2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 129213637) has the molecular formula C10H11F3N2O5 and a molecular weight of 296.20 g/mol. Its IUPAC name is (3-methyl-2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 129213637 |
| Molecular Formula | C10H11F3N2O5 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | CC1CC(=O)N(OC(=O)C(C)NC(=O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C10H11F3N2O5/c1-4-3-6(16)15(7(4)17)20-8(18)5(2)14-9(19)10(11,12)13/h4-5H,3H2,1-2H3,(H,14,19) |
| InChIKey | OXLLSYJLUBPJSJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|