C24H25FN6O3S — CID 129213976
3-fluoro-N,N-dimethyl-5-[4-[[[(methyliminomethylamino)-(pyridin-4-ylamino)methylidene]amino]methyl]phenyl]sulfonylbenzamide (PubChem CID 129213976) has the molecular formula C24H25FN6O3S and a molecular weight of 496.57 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethyl-5-[4-[[[(methyliminomethylamino)-(pyridin-4-ylamino)methylidene]amino]methyl]phenyl]sulfonylbenzamide.
| Compound Name | 3-fluoro-N,N-dimethyl-5-[4-[[[(methyliminomethylamino)-(pyridin-4-ylamino)methylidene]amino]methyl]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 129213976 |
| Molecular Formula | C24H25FN6O3S |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 3-fluoro-N,N-dimethyl-5-[4-[[[(methyliminomethylamino)-(pyridin-4-ylamino)methylidene]amino]methyl]phenyl]sulfonylbenzamide |
| SMILES | C/N=C/N/C(=N\Cc1ccc(S(=O)(=O)c2cc(F)cc(C(=O)N(C)C)c2)cc1)Nc1ccncc1 |
| InChI | InChI=1S/C24H25FN6O3S/c1-26-16-29-24(30-20-8-10-27-11-9-20)28-15-17-4-6-21(7-5-17)35(33,34)22-13-18(12-19(25)14-22)23(32)31(2)3/h4-14,16H,15H2,1-3H3,(H2,26,27,28,29,30) |
| InChIKey | HHLZDPSPKZCPQJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|