2-methylpent-4-enoyl chloride

C6H9ClO — CID 12921442

IUPAC2-methylpent-4-enoyl chloride
SMILESC=CCC(C)C(=O)Cl
InChIInChI=1S/C6H9ClO/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3
InChIKeyHTTKEPDLBPWWPK-UHFFFAOYSA-N
MW132.59 g/mol
LogP1.96
Rot. Bonds3

About 2-methylpent-4-enoyl chloride

2-methylpent-4-enoyl chloride (PubChem CID 12921442) has the molecular formula C6H9ClO and a molecular weight of 132.59 g/mol. Its IUPAC name is 2-methylpent-4-enoyl chloride.

Molecular Properties

Compound Name2-methylpent-4-enoyl chloride
PubChem CID12921442
Molecular FormulaC6H9ClO
Molecular Weight132.59 g/mol
Exact Mass132.03
IUPAC Name2-methylpent-4-enoyl chloride
SMILESC=CCC(C)C(=O)Cl
InChIInChI=1S/C6H9ClO/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3
InChIKeyHTTKEPDLBPWWPK-UHFFFAOYSA-N
XLogP1.96
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.59
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-methylpent-4-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpent-4-enoyl chloride?
The IUPAC name of 2-methylpent-4-enoyl chloride (CID 12921442) is 2-methylpent-4-enoyl chloride.
What is the SMILES notation for 2-methylpent-4-enoyl chloride?
The canonical SMILES for 2-methylpent-4-enoyl chloride is C=CCC(C)C(=O)Cl.
What is the InChIKey of 2-methylpent-4-enoyl chloride?
The InChIKey is HTTKEPDLBPWWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3.
What are the key properties of 2-methylpent-4-enoyl chloride?
2-methylpent-4-enoyl chloride has a molecular weight of 132.59 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpent-4-enoyl chloride is sourced from PubChem (CID 12921442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).