C13H24FN — CID 129214791
(1Z,6S,7E)-8-fluoro-N,5,6-trimethyldeca-1,7-dien-1-amine (PubChem CID 129214791) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is (1Z,6S,7E)-8-fluoro-N,5,6-trimethyldeca-1,7-dien-1-amine.
| Compound Name | (1Z,6S,7E)-8-fluoro-N,5,6-trimethyldeca-1,7-dien-1-amine |
|---|---|
| PubChem CID | 129214791 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (1Z,6S,7E)-8-fluoro-N,5,6-trimethyldeca-1,7-dien-1-amine |
| SMILES | CC/C(F)=C\[C@@H](C)C(C)CC/C=C\NC |
| InChI | InChI=1S/C13H24FN/c1-5-13(14)10-12(3)11(2)8-6-7-9-15-4/h7,9-12,15H,5-6,8H2,1-4H3/b9-7-,13-10+/t11?,12-/m1/s1 |
| InChIKey | CIUMHJXCNFWKFL-NHJILIHCSA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |