About (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine
(3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine (PubChem CID 129214829) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine.
Molecular Properties
| Compound Name | (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine |
| PubChem CID | 129214829 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine |
| SMILES | C=CCS(=O)(=O)/C1=C/CC=C/C=N\C1 |
| InChI | InChI=1S/C10H13NO2S/c1-2-8-14(12,13)10-6-4-3-5-7-11-9-10/h2-3,5-7H,1,4,8-9H2/b5-3?,10-6+,11-7- |
| InChIKey | VHEBNISMKALLRY-CAMSVMPDSA-N |
| XLogP | 1.50 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine?
The IUPAC name of (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine (CID 129214829) is (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine.
What is the SMILES notation for (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine?
The canonical SMILES for (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine is C=CCS(=O)(=O)/C1=C/CC=C/C=N\C1.
What is the InChIKey of (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine?
The InChIKey is VHEBNISMKALLRY-CAMSVMPDSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-2-8-14(12,13)10-6-4-3-5-7-11-9-10/h2-3,5-7H,1,4,8-9H2/b5-3?,10-6+,11-7-.
What are the key properties of (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine?
(3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine has a molecular weight of 211.29 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-prop-2-enylsulfonyl-2,5-dihydroazocine is sourced from PubChem (CID 129214829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).