C13H8S2 — CID 129214831
3,9-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene (PubChem CID 129214831) has the molecular formula C13H8S2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3,9-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene.
| Compound Name | 3,9-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene |
|---|---|
| PubChem CID | 129214831 |
| Molecular Formula | C13H8S2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 3,9-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2(6),4,7,10,13-hexaene |
| SMILES | C1=Cc2c(c3sccc3c3cscc23)C1 |
| InChI | InChI=1S/C13H8S2/c1-2-8-9(3-1)13-10(4-5-15-13)12-7-14-6-11(8)12/h1-2,4-7H,3H2 |
| InChIKey | ZGXXMEXKTHLGIG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |