About 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine
2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine (PubChem CID 129214836) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine.
Molecular Properties
| Compound Name | 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine |
| PubChem CID | 129214836 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine |
| SMILES | C=CC1=C(/C=C\C)N(C)C(C/C(C)=C/C)=C(C=C)O1 |
| InChI | InChI=1S/C17H23NO/c1-7-11-14-16(9-3)19-17(10-4)15(18(14)6)12-13(5)8-2/h7-11H,3-4,12H2,1-2,5-6H3/b11-7-,13-8+ |
| InChIKey | OIFQBCIUAKCDMI-JKNYEHFOSA-N |
| XLogP | 4.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine?
The IUPAC name of 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine (CID 129214836) is 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine.
What is the SMILES notation for 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine?
The canonical SMILES for 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine is C=CC1=C(/C=C\C)N(C)C(C/C(C)=C/C)=C(C=C)O1.
What is the InChIKey of 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine?
The InChIKey is OIFQBCIUAKCDMI-JKNYEHFOSA-N. The full InChI is InChI=1S/C17H23NO/c1-7-11-14-16(9-3)19-17(10-4)15(18(14)6)12-13(5)8-2/h7-11H,3-4,12H2,1-2,5-6H3/b11-7-,13-8+.
What are the key properties of 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine?
2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine has a molecular weight of 257.38 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(ethenyl)-4-methyl-3-[(E)-2-methylbut-2-enyl]-5-[(Z)-prop-1-enyl]-1,4-oxazine is sourced from PubChem (CID 129214836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).