C21H40N2 — CID 129214843
N-[3-[(6E,10Z)-dodeca-6,10-dienyl]iminobutyl]pentan-3-amine (PubChem CID 129214843) has the molecular formula C21H40N2 and a molecular weight of 320.57 g/mol. Its IUPAC name is N-[3-[(6E,10Z)-dodeca-6,10-dienyl]iminobutyl]pentan-3-amine.
| Compound Name | N-[3-[(6E,10Z)-dodeca-6,10-dienyl]iminobutyl]pentan-3-amine |
|---|---|
| PubChem CID | 129214843 |
| Molecular Formula | C21H40N2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.32 |
| IUPAC Name | N-[3-[(6E,10Z)-dodeca-6,10-dienyl]iminobutyl]pentan-3-amine |
| SMILES | C/C=C\CC/C=C/CCCCC/N=C(\C)CCNC(CC)CC |
| InChI | InChI=1S/C21H40N2/c1-5-8-9-10-11-12-13-14-15-16-18-22-20(4)17-19-23-21(6-2)7-3/h5,8,11-12,21,23H,6-7,9-10,13-19H2,1-4H3/b8-5-,12-11+,22-20+ |
| InChIKey | FKFNOKDODCSWQP-UMWFPNHJSA-N |
| XLogP | 6.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|