About 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide
3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide (PubChem CID 129214860) has the molecular formula C19H26N2O
and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide |
| PubChem CID | 129214860 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide |
| SMILES | C=C(C)CCNC(=O)C1=NCC(CCCC2=CCCC=C2)=C1 |
| InChI | InChI=1S/C19H26N2O/c1-15(2)11-12-20-19(22)18-13-17(14-21-18)10-6-9-16-7-4-3-5-8-16/h4,7-8,13H,1,3,5-6,9-12,14H2,2H3,(H,20,22) |
| InChIKey | HJGWQCHLCSSJSI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide?
The IUPAC name of 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide (CID 129214860) is 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide.
What is the SMILES notation for 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide?
The canonical SMILES for 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide is C=C(C)CCNC(=O)C1=NCC(CCCC2=CCCC=C2)=C1.
What is the InChIKey of 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide?
The InChIKey is HJGWQCHLCSSJSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O/c1-15(2)11-12-20-19(22)18-13-17(14-21-18)10-6-9-16-7-4-3-5-8-16/h4,7-8,13H,1,3,5-6,9-12,14H2,2H3,(H,20,22).
What are the key properties of 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide?
3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide has a molecular weight of 298.43 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyclohexa-1,5-dien-1-ylpropyl)-N-(3-methylbut-3-enyl)-2H-pyrrole-5-carboxamide is sourced from PubChem (CID 129214860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).