C47H61ClN2O10 — CID 129214926
[6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate (PubChem CID 129214926) has the molecular formula C47H61ClN2O10 and a molecular weight of 849.46 g/mol. Its IUPAC name is [6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate.
| Compound Name | [6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129214926 |
| Molecular Formula | C47H61ClN2O10 |
| Molecular Weight | 849.46 g/mol |
| Exact Mass | 848.40 |
| IUPAC Name | [6-[[6-[2-[2-(6-chlorohexoxy)ethoxy]ethylamino]-6-oxohexyl]carbamoyl]-6'-(2,2-dimethylpropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)COc1ccc2c(c1)Oc1cc(OC(=O)C(C)(C)C)ccc1C21OC(=O)c2ccc(C(=O)NCCCCCC(=O)NCCOCCOCCCCCCCl)cc21 |
| InChI | InChI=1S/C47H61ClN2O10/c1-45(2,3)31-57-33-16-19-36-39(29-33)59-40-30-34(58-44(54)46(4,5)6)17-20-37(40)47(36)38-28-32(15-18-35(38)43(53)60-47)42(52)50-22-12-9-10-14-41(51)49-23-25-56-27-26-55-24-13-8-7-11-21-48/h15-20,28-30H,7-14,21-27,31H2,1-6H3,(H,49,51)(H,50,52) |
| InChIKey | SVSLARGLUUUNSI-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.46 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|