About 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol
6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol (PubChem CID 129214942) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol.
Molecular Properties
| Compound Name | 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol |
| PubChem CID | 129214942 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol |
| SMILES | OCCCCC#CC1=CC=C(F)CC1 |
| InChI | InChI=1S/C12H15FO/c13-12-8-6-11(7-9-12)5-3-1-2-4-10-14/h6,8,14H,1-2,4,7,9-10H2 |
| InChIKey | LDCGRVDMNYCEBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol?
The IUPAC name of 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol (CID 129214942) is 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol.
What is the SMILES notation for 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol?
The canonical SMILES for 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol is OCCCCC#CC1=CC=C(F)CC1.
What is the InChIKey of 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol?
The InChIKey is LDCGRVDMNYCEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO/c13-12-8-6-11(7-9-12)5-3-1-2-4-10-14/h6,8,14H,1-2,4,7,9-10H2.
What are the key properties of 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol?
6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol has a molecular weight of 194.25 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorocyclohexa-1,3-dien-1-yl)hex-5-yn-1-ol is sourced from PubChem (CID 129214942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).