C21H27IO7S — CID 129215101
[(1R,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-iodobenzenesulfonate (PubChem CID 129215101) has the molecular formula C21H27IO7S and a molecular weight of 550.41 g/mol. Its IUPAC name is [(1R,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-iodobenzenesulfonate.
| Compound Name | [(1R,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-iodobenzenesulfonate |
|---|---|
| PubChem CID | 129215101 |
| Molecular Formula | C21H27IO7S |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | [(1R,5R,9R,10R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-iodobenzenesulfonate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OS(=O)(=O)c3ccc(I)cc3)O[C@@H]3O[C@@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C21H27IO7S/c1-12-4-9-17-13(2)18(27-30(23,24)15-7-5-14(22)6-8-15)25-19-21(17)16(12)10-11-20(3,26-19)28-29-21/h5-8,12-13,16-19H,4,9-11H2,1-3H3/t12-,13-,16?,17?,18-,19-,20-,21-/m1/s1 |
| InChIKey | OEIOKEFFAGEBMD-IBZBARLDSA-N |
| XLogP | 4.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|