C26H39N3 — CID 129215157
(1Z,3E)-4-N-[(1E,3Z,5Z)-7-cyclopropyl-3,5-diethylhepta-1,3,5-trienyl]-1-N-[(E)-2-methylbut-2-enyl]-1-(methylideneamino)hexa-1,3,5-triene-1,4-diamine (PubChem CID 129215157) has the molecular formula C26H39N3 and a molecular weight of 393.62 g/mol. Its IUPAC name is (1Z,3E)-4-N-[(1E,3Z,5Z)-7-cyclopropyl-3,5-diethylhepta-1,3,5-trienyl]-1-N-[(E)-2-methylbut-2-enyl]-1-(methylideneamino)hexa-1,3,5-triene-1,4-diamine.
| Compound Name | (1Z,3E)-4-N-[(1E,3Z,5Z)-7-cyclopropyl-3,5-diethylhepta-1,3,5-trienyl]-1-N-[(E)-2-methylbut-2-enyl]-1-(methylideneamino)hexa-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 129215157 |
| Molecular Formula | C26H39N3 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | (1Z,3E)-4-N-[(1E,3Z,5Z)-7-cyclopropyl-3,5-diethylhepta-1,3,5-trienyl]-1-N-[(E)-2-methylbut-2-enyl]-1-(methylideneamino)hexa-1,3,5-triene-1,4-diamine |
| SMILES | C=C/C(=C\C=C(/N=C)NC/C(C)=C/C)N/C=C/C(=C\C(=C/CC1CC1)CC)CC |
| InChI | InChI=1S/C26H39N3/c1-7-21(5)20-29-26(27-6)16-15-25(10-4)28-18-17-23(9-3)19-22(8-2)11-12-24-13-14-24/h7,10-11,15-19,24,28-29H,4,6,8-9,12-14,20H2,1-3,5H3/b18-17+,21-7+,22-11-,23-19-,25-15+,26-16+ |
| InChIKey | LTYXRRYUQRJEHE-HPGQMURVSA-N |
| XLogP | 6.73 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|