About (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine
(Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine (PubChem CID 129215159) has the molecular formula C17H31N
and a molecular weight of 249.44 g/mol. Its IUPAC name is (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine |
| PubChem CID | 129215159 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine |
| SMILES | C=C/C(=C/CCC)C(C)C(C)CNCC/C=C\C |
| InChI | InChI=1S/C17H31N/c1-6-9-11-13-18-14-15(4)16(5)17(8-3)12-10-7-2/h6,8-9,12,15-16,18H,3,7,10-11,13-14H2,1-2,4-5H3/b9-6-,17-12- |
| InChIKey | VPQPRNIUGUGEPQ-NEFJZHHBSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine?
The IUPAC name of (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine (CID 129215159) is (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine.
What is the SMILES notation for (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine?
The canonical SMILES for (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine is C=C/C(=C/CCC)C(C)C(C)CNCC/C=C\C.
What is the InChIKey of (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine?
The InChIKey is VPQPRNIUGUGEPQ-NEFJZHHBSA-N. The full InChI is InChI=1S/C17H31N/c1-6-9-11-13-18-14-15(4)16(5)17(8-3)12-10-7-2/h6,8-9,12,15-16,18H,3,7,10-11,13-14H2,1-2,4-5H3/b9-6-,17-12-.
What are the key properties of (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine?
(Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine has a molecular weight of 249.44 g/mol, XLogP of 4.73, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-ethenyl-2,3-dimethyl-N-[(Z)-pent-3-enyl]oct-4-en-1-amine is sourced from PubChem (CID 129215159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).