C23H30S — CID 129215218
(2E,5Z,7E,9E,12E,13E)-7-ethyl-12-ethylidene-10-ethynyl-4-methylidene-11-methylsulfanylpentadeca-2,5,7,9,13-pentaene (PubChem CID 129215218) has the molecular formula C23H30S and a molecular weight of 338.56 g/mol. Its IUPAC name is (2E,5Z,7E,9E,12E,13E)-7-ethyl-12-ethylidene-10-ethynyl-4-methylidene-11-methylsulfanylpentadeca-2,5,7,9,13-pentaene.
| Compound Name | (2E,5Z,7E,9E,12E,13E)-7-ethyl-12-ethylidene-10-ethynyl-4-methylidene-11-methylsulfanylpentadeca-2,5,7,9,13-pentaene |
|---|---|
| PubChem CID | 129215218 |
| Molecular Formula | C23H30S |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (2E,5Z,7E,9E,12E,13E)-7-ethyl-12-ethylidene-10-ethynyl-4-methylidene-11-methylsulfanylpentadeca-2,5,7,9,13-pentaene |
| SMILES | C#C/C(=C\C=C(\C=C/C(=C)/C=C/C)CC)C(SC)C(/C=C/C)=C/C |
| InChI | InChI=1S/C23H30S/c1-8-13-19(6)15-16-20(10-3)17-18-22(12-5)23(24-7)21(11-4)14-9-2/h5,8-9,11,13-18,23H,6,10H2,1-4,7H3/b13-8+,14-9+,16-15-,20-17+,21-11+,22-18+ |
| InChIKey | CRIMDIFKWAXEEB-BOZICKTKSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|