C17H21N — CID 129215230
(4E)-N-(4,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-ethenylhexa-1,4-dien-3-imine (PubChem CID 129215230) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (4E)-N-(4,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-ethenylhexa-1,4-dien-3-imine.
| Compound Name | (4E)-N-(4,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-ethenylhexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 129215230 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (4E)-N-(4,7-dimethylcyclohepta-1,4,6-trien-1-yl)-4-ethenylhexa-1,4-dien-3-imine |
| SMILES | C=CC(=NC1=CCC(C)=CC=C1C)/C(C=C)=C/C |
| InChI | InChI=1S/C17H21N/c1-6-15(7-2)16(8-3)18-17-12-10-13(4)9-11-14(17)5/h6-9,11-12H,1,3,10H2,2,4-5H3/b15-7+,18-16+ |
| InChIKey | HMRLVTCGTCTGKK-VKZGXTEYSA-N |
| XLogP | 4.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|