C22H41N — CID 129215252
(6Z,8Z)-N,7-dimethyl-3-[(Z)-2-methylbut-1-enyl]-5-(3-methylbutyl)deca-6,8-dien-1-amine (PubChem CID 129215252) has the molecular formula C22H41N and a molecular weight of 319.58 g/mol. Its IUPAC name is (6Z,8Z)-N,7-dimethyl-3-[(Z)-2-methylbut-1-enyl]-5-(3-methylbutyl)deca-6,8-dien-1-amine.
| Compound Name | (6Z,8Z)-N,7-dimethyl-3-[(Z)-2-methylbut-1-enyl]-5-(3-methylbutyl)deca-6,8-dien-1-amine |
|---|---|
| PubChem CID | 129215252 |
| Molecular Formula | C22H41N |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 319.32 |
| IUPAC Name | (6Z,8Z)-N,7-dimethyl-3-[(Z)-2-methylbut-1-enyl]-5-(3-methylbutyl)deca-6,8-dien-1-amine |
| SMILES | C/C=C\C(C)=C/C(CCC(C)C)CC(/C=C(/C)CC)CCNC |
| InChI | InChI=1S/C22H41N/c1-8-10-20(6)16-21(12-11-18(3)4)17-22(13-14-23-7)15-19(5)9-2/h8,10,15-16,18,21-23H,9,11-14,17H2,1-7H3/b10-8-,19-15-,20-16- |
| InChIKey | VMUVWADQNDKNHF-SNXPAKOSSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|