C23H40N2 — CID 129215273
(1E,3Z,5Z)-N'-[(Z)-but-2-enyl]-N-methyl-3,5-di(propan-2-yl)-N'-prop-1-en-2-ylnona-1,3,5-triene-1,9-diamine (PubChem CID 129215273) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is (1E,3Z,5Z)-N'-[(Z)-but-2-enyl]-N-methyl-3,5-di(propan-2-yl)-N'-prop-1-en-2-ylnona-1,3,5-triene-1,9-diamine.
| Compound Name | (1E,3Z,5Z)-N'-[(Z)-but-2-enyl]-N-methyl-3,5-di(propan-2-yl)-N'-prop-1-en-2-ylnona-1,3,5-triene-1,9-diamine |
|---|---|
| PubChem CID | 129215273 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | (1E,3Z,5Z)-N'-[(Z)-but-2-enyl]-N-methyl-3,5-di(propan-2-yl)-N'-prop-1-en-2-ylnona-1,3,5-triene-1,9-diamine |
| SMILES | C=C(C)N(C/C=C\C)CCC/C=C(\C=C(/C=C/NC)C(C)C)C(C)C |
| InChI | InChI=1S/C23H40N2/c1-9-10-16-25(21(6)7)17-12-11-13-22(19(2)3)18-23(20(4)5)14-15-24-8/h9-10,13-15,18-20,24H,6,11-12,16-17H2,1-5,7-8H3/b10-9-,15-14+,22-13+,23-18+ |
| InChIKey | BQJMZBHITWVINU-DVJKPRROSA-N |
| XLogP | 6.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|