C17H24N2 — CID 129215298
(2E)-3-N-[(1E,3Z)-3,6-dimethylhepta-1,3,5-trienyl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine (PubChem CID 129215298) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (2E)-3-N-[(1E,3Z)-3,6-dimethylhepta-1,3,5-trienyl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine.
| Compound Name | (2E)-3-N-[(1E,3Z)-3,6-dimethylhepta-1,3,5-trienyl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine |
|---|---|
| PubChem CID | 129215298 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (2E)-3-N-[(1E,3Z)-3,6-dimethylhepta-1,3,5-trienyl]-2-ethylidene-1-N-methylpent-4-ene-1,3-diimine |
| SMILES | C=CC(=N\C=C\C(C)=C/C=C(C)C)/C(/C=N/C)=C/C |
| InChI | InChI=1S/C17H24N2/c1-7-16(13-18-6)17(8-2)19-12-11-15(5)10-9-14(3)4/h7-13H,2H2,1,3-6H3/b12-11+,15-10-,16-7+,18-13+,19-17+ |
| InChIKey | YDMWMNMBLOZCGS-ASWFZBLZSA-N |
| XLogP | 4.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|