C11H10O6 — CID 129215324
11-hydroxy-4,10-dioxatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9-trione (PubChem CID 129215324) has the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. Its IUPAC name is 11-hydroxy-4,10-dioxatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9-trione.
| Compound Name | 11-hydroxy-4,10-dioxatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9-trione |
|---|---|
| PubChem CID | 129215324 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 11-hydroxy-4,10-dioxatetracyclo[5.5.1.02,6.08,12]tridecane-3,5,9-trione |
| SMILES | O=C1OC(=O)C2C3CC(C12)C1C(=O)OC(O)C31 |
| InChI | InChI=1S/C11H10O6/c12-8-4-2-1-3(6(4)10(14)16-8)7-5(2)9(13)17-11(7)15/h2-8,12H,1H2 |
| InChIKey | VFYWMDPGXHUGGN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|