C30H23F3N4 — CID 129215476
2,5-dimethyl-19-phenyl-9-[2-(trifluoromethyl)phenyl]-12,14,17,19-tetrazapentacyclo[10.7.0.02,5.06,11.013,18]nonadeca-3,6(11),7,9,13,15,17-heptaene (PubChem CID 129215476) has the molecular formula C30H23F3N4 and a molecular weight of 496.54 g/mol. Its IUPAC name is 2,5-dimethyl-19-phenyl-9-[2-(trifluoromethyl)phenyl]-12,14,17,19-tetrazapentacyclo[10.7.0.02,5.06,11.013,18]nonadeca-3,6(11),7,9,13,15,17-heptaene.
| Compound Name | 2,5-dimethyl-19-phenyl-9-[2-(trifluoromethyl)phenyl]-12,14,17,19-tetrazapentacyclo[10.7.0.02,5.06,11.013,18]nonadeca-3,6(11),7,9,13,15,17-heptaene |
|---|---|
| PubChem CID | 129215476 |
| Molecular Formula | C30H23F3N4 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2,5-dimethyl-19-phenyl-9-[2-(trifluoromethyl)phenyl]-12,14,17,19-tetrazapentacyclo[10.7.0.02,5.06,11.013,18]nonadeca-3,6(11),7,9,13,15,17-heptaene |
| SMILES | CC12C=CC1(C)C1N(c3ccccc3)c3nccnc3N1c1cc(-c3ccccc3C(F)(F)F)ccc12 |
| InChI | InChI=1S/C30H23F3N4/c1-28-14-15-29(28,2)27-36(20-8-4-3-5-9-20)25-26(35-17-16-34-25)37(27)24-18-19(12-13-23(24)28)21-10-6-7-11-22(21)30(31,32)33/h3-18,27H,1-2H3 |
| InChIKey | OCDLPGCLJYULML-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|