About 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone
1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 129215798) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone |
| PubChem CID | 129215798 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | [H]/N=C(\C)C1=CC(C(C)=O)=CCC1 |
| InChI | InChI=1S/C10H13NO/c1-7(11)9-4-3-5-10(6-9)8(2)12/h5-6,11H,3-4H2,1-2H3/b11-7+ |
| InChIKey | UBWKWXGOZXRHOG-YRNVUSSQSA-N |
| XLogP | 2.26 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone?
The IUPAC name of 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone (CID 129215798) is 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone.
What is the SMILES notation for 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone?
The canonical SMILES for 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone is [H]/N=C(\C)C1=CC(C(C)=O)=CCC1.
What is the InChIKey of 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone?
The InChIKey is UBWKWXGOZXRHOG-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H13NO/c1-7(11)9-4-3-5-10(6-9)8(2)12/h5-6,11H,3-4H2,1-2H3/b11-7+.
What are the key properties of 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone?
1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone has a molecular weight of 163.22 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethanimidoylcyclohexa-1,5-dien-1-yl)ethanone is sourced from PubChem (CID 129215798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).