About (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one
(4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one (PubChem CID 129215808) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one.
Molecular Properties
| Compound Name | (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one |
| PubChem CID | 129215808 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one |
| SMILES | [H]/N=C/C=C(\C=C/C)C(=O)C=C |
| InChI | InChI=1S/C9H11NO/c1-3-5-8(6-7-10)9(11)4-2/h3-7,10H,2H2,1H3/b5-3-,8-6+,10-7+ |
| InChIKey | UXWAYQIEYZLIAH-IHRINHRHSA-N |
| XLogP | 1.89 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one?
The IUPAC name of (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one (CID 129215808) is (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one.
What is the SMILES notation for (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one?
The canonical SMILES for (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one is [H]/N=C/C=C(\C=C/C)C(=O)C=C.
What is the InChIKey of (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one?
The InChIKey is UXWAYQIEYZLIAH-IHRINHRHSA-N. The full InChI is InChI=1S/C9H11NO/c1-3-5-8(6-7-10)9(11)4-2/h3-7,10H,2H2,1H3/b5-3-,8-6+,10-7+.
What are the key properties of (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one?
(4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one has a molecular weight of 149.19 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5Z)-4-(2-iminoethylidene)hepta-1,5-dien-3-one is sourced from PubChem (CID 129215808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).