C21H23FN2O4S — CID 129215810
(Z)-5-fluoro-N-[4-(furan-2-yl)-5-(oxane-4-carbonyl)-1,3-thiazol-2-yl]-2-methylidenehept-3-enamide (PubChem CID 129215810) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is (Z)-5-fluoro-N-[4-(furan-2-yl)-5-(oxane-4-carbonyl)-1,3-thiazol-2-yl]-2-methylidenehept-3-enamide.
| Compound Name | (Z)-5-fluoro-N-[4-(furan-2-yl)-5-(oxane-4-carbonyl)-1,3-thiazol-2-yl]-2-methylidenehept-3-enamide |
|---|---|
| PubChem CID | 129215810 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (Z)-5-fluoro-N-[4-(furan-2-yl)-5-(oxane-4-carbonyl)-1,3-thiazol-2-yl]-2-methylidenehept-3-enamide |
| SMILES | C=C(/C=C\C(F)CC)C(=O)Nc1nc(-c2ccco2)c(C(=O)C2CCOCC2)s1 |
| InChI | InChI=1S/C21H23FN2O4S/c1-3-15(22)7-6-13(2)20(26)24-21-23-17(16-5-4-10-28-16)19(29-21)18(25)14-8-11-27-12-9-14/h4-7,10,14-15H,2-3,8-9,11-12H2,1H3,(H,23,24,26)/b7-6- |
| InChIKey | MQWYIASXPZLNLD-SREVYHEPSA-N |
| XLogP | 4.81 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|