About 3-methylsulfinyl-3,4-dihydro-2H-pyran
3-methylsulfinyl-3,4-dihydro-2H-pyran (PubChem CID 129215890) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 3-methylsulfinyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 3-methylsulfinyl-3,4-dihydro-2H-pyran |
| PubChem CID | 129215890 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 3-methylsulfinyl-3,4-dihydro-2H-pyran |
| SMILES | CS(=O)C1CC=COC1 |
| InChI | InChI=1S/C6H10O2S/c1-9(7)6-3-2-4-8-5-6/h2,4,6H,3,5H2,1H3 |
| InChIKey | YUKAVNCBQPQRMP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylsulfinyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfinyl-3,4-dihydro-2H-pyran?
The IUPAC name of 3-methylsulfinyl-3,4-dihydro-2H-pyran (CID 129215890) is 3-methylsulfinyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 3-methylsulfinyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 3-methylsulfinyl-3,4-dihydro-2H-pyran is CS(=O)C1CC=COC1.
What is the InChIKey of 3-methylsulfinyl-3,4-dihydro-2H-pyran?
The InChIKey is YUKAVNCBQPQRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-9(7)6-3-2-4-8-5-6/h2,4,6H,3,5H2,1H3.
What are the key properties of 3-methylsulfinyl-3,4-dihydro-2H-pyran?
3-methylsulfinyl-3,4-dihydro-2H-pyran has a molecular weight of 146.21 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfinyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 129215890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).