C12H18N2O2 — CID 129215893
(3Z,5Z)-3-amino-7-morpholin-4-ylocta-3,5,7-trien-2-one (PubChem CID 129215893) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (3Z,5Z)-3-amino-7-morpholin-4-ylocta-3,5,7-trien-2-one.
| Compound Name | (3Z,5Z)-3-amino-7-morpholin-4-ylocta-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 129215893 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3Z,5Z)-3-amino-7-morpholin-4-ylocta-3,5,7-trien-2-one |
| SMILES | C=C(/C=C\C=C(/N)C(C)=O)N1CCOCC1 |
| InChI | InChI=1S/C12H18N2O2/c1-10(14-6-8-16-9-7-14)4-3-5-12(13)11(2)15/h3-5H,1,6-9,13H2,2H3/b4-3-,12-5- |
| InChIKey | RXVIPGNRXXAHOT-HVSXSXIDSA-N |
| XLogP | 0.82 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|