About 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one
4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one (PubChem CID 129215976) has the molecular formula C16H21N5O
and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one |
| PubChem CID | 129215976 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one |
| SMILES | C=C1NN=C(C)C(=O)N1/N=C/c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C16H21N5O/c1-5-20(6-2)15-9-7-14(8-10-15)11-17-21-13(4)19-18-12(3)16(21)22/h7-11,19H,4-6H2,1-3H3/b17-11+ |
| InChIKey | AJHJRBANSWAXTM-GZTJUZNOSA-N |
| XLogP | 2.15 |
| TPSA | 60.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one?
The IUPAC name of 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one (CID 129215976) is 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one.
What is the SMILES notation for 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one?
The canonical SMILES for 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one is C=C1NN=C(C)C(=O)N1/N=C/c1ccc(N(CC)CC)cc1.
What is the InChIKey of 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one?
The InChIKey is AJHJRBANSWAXTM-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H21N5O/c1-5-20(6-2)15-9-7-14(8-10-15)11-17-21-13(4)19-18-12(3)16(21)22/h7-11,19H,4-6H2,1-3H3/b17-11+.
What are the key properties of 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one?
4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one has a molecular weight of 299.38 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-[4-(diethylamino)phenyl]methylideneamino]-6-methyl-3-methylidene-2H-1,2,4-triazin-5-one is sourced from PubChem (CID 129215976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).