C11H16O2 — CID 129215999
1,5,5-trimethylbicyclo[2.1.1]hexane-2,2-dicarbaldehyde (PubChem CID 129215999) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,5,5-trimethylbicyclo[2.1.1]hexane-2,2-dicarbaldehyde.
| Compound Name | 1,5,5-trimethylbicyclo[2.1.1]hexane-2,2-dicarbaldehyde |
|---|---|
| PubChem CID | 129215999 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1,5,5-trimethylbicyclo[2.1.1]hexane-2,2-dicarbaldehyde |
| SMILES | CC1(C)C2CC(C=O)(C=O)C1(C)C2 |
| InChI | InChI=1S/C11H16O2/c1-9(2)8-4-10(9,3)11(5-8,6-12)7-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | LWIDZENJWIDSQX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|