About but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate
but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate (PubChem CID 129216291) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate.
Molecular Properties
| Compound Name | but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate |
| PubChem CID | 129216291 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate |
| SMILES | C=CCCOC(=O)C(C)C1(C)CCCC1(C)C |
| InChI | InChI=1S/C15H26O2/c1-6-7-11-17-13(16)12(2)15(5)10-8-9-14(15,3)4/h6,12H,1,7-11H2,2-5H3 |
| InChIKey | QQNCLPDQSYVHLJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate?
The IUPAC name of but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate (CID 129216291) is but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate.
What is the SMILES notation for but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate?
The canonical SMILES for but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate is C=CCCOC(=O)C(C)C1(C)CCCC1(C)C.
What is the InChIKey of but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate?
The InChIKey is QQNCLPDQSYVHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-6-7-11-17-13(16)12(2)15(5)10-8-9-14(15,3)4/h6,12H,1,7-11H2,2-5H3.
What are the key properties of but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate?
but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate has a molecular weight of 238.37 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-(1,2,2-trimethylcyclopentyl)propanoate is sourced from PubChem (CID 129216291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).