C17H17F5N2O3 — CID 129216363
(2S)-N-[4-cyclopropyl-3-(2,2,2-trifluoroethoxy)benzoyl]-4,4-difluoropyrrolidine-2-carboxamide (PubChem CID 129216363) has the molecular formula C17H17F5N2O3 and a molecular weight of 392.32 g/mol. Its IUPAC name is (2S)-N-[4-cyclopropyl-3-(2,2,2-trifluoroethoxy)benzoyl]-4,4-difluoropyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-cyclopropyl-3-(2,2,2-trifluoroethoxy)benzoyl]-4,4-difluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129216363 |
| Molecular Formula | C17H17F5N2O3 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (2S)-N-[4-cyclopropyl-3-(2,2,2-trifluoroethoxy)benzoyl]-4,4-difluoropyrrolidine-2-carboxamide |
| SMILES | O=C(NC(=O)[C@@H]1CC(F)(F)CN1)c1ccc(C2CC2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F5N2O3/c18-16(19)6-12(23-7-16)15(26)24-14(25)10-3-4-11(9-1-2-9)13(5-10)27-8-17(20,21)22/h3-5,9,12,23H,1-2,6-8H2,(H,24,25,26)/t12-/m0/s1 |
| InChIKey | YNQTXVWUIVMVQU-LBPRGKRZSA-N |
| XLogP | 2.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|