C20H20F6N6O2 — CID 129216481
N-[(1S,5R)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129216481) has the molecular formula C20H20F6N6O2 and a molecular weight of 490.41 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129216481 |
| Molecular Formula | C20H20F6N6O2 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(OCC(F)(F)F)ccc(C(F)(F)F)n3n2)on1 |
| InChI | InChI=1S/C20H20F6N6O2/c1-10-6-15(34-30-10)31-7-11-2-3-12(8-31)16(11)27-18-28-17-13(33-9-19(21,22)23)4-5-14(20(24,25)26)32(17)29-18/h4-6,11-12,16H,2-3,7-9H2,1H3,(H,27,29)/t11-,12+,16? |
| InChIKey | HDAAHXJBMLLYLE-HBBFGDNQSA-N |
| XLogP | 4.31 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |