C11H15FN4 — CID 129216597
3-(5-fluoropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-amine (PubChem CID 129216597) has the molecular formula C11H15FN4 and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-(5-fluoropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-amine.
| Compound Name | 3-(5-fluoropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-amine |
|---|---|
| PubChem CID | 129216597 |
| Molecular Formula | C11H15FN4 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-(5-fluoropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-amine |
| SMILES | NC1C2CCC1CN(c1ncncc1F)C2 |
| InChI | InChI=1S/C11H15FN4/c12-9-3-14-6-15-11(9)16-4-7-1-2-8(5-16)10(7)13/h3,6-8,10H,1-2,4-5,13H2 |
| InChIKey | PZWACQZOWUJAGU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |